About 1-prop-1-ynyltricyclo[4.1.0.02,7]heptane
1-prop-1-ynyltricyclo[4.1.0.02,7]heptane (PubChem CID 45079181) has the molecular formula C10H12
and a molecular weight of 132.21 g/mol. Its IUPAC name is 1-prop-1-ynyltricyclo[4.1.0.02,7]heptane.
Molecular Properties
| Compound Name | 1-prop-1-ynyltricyclo[4.1.0.02,7]heptane |
| PubChem CID | 45079181 |
| Molecular Formula | C10H12 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | 1-prop-1-ynyltricyclo[4.1.0.02,7]heptane |
| SMILES | CC#CC12C3CCCC1C32 |
| InChI | InChI=1S/C10H12/c1-2-6-10-7-4-3-5-8(10)9(7)10/h7-9H,3-5H2,1H3 |
| InChIKey | ZCEXWVNICHUBNB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-1-ynyltricyclo[4.1.0.02,7]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-1-ynyltricyclo[4.1.0.02,7]heptane?
The IUPAC name of 1-prop-1-ynyltricyclo[4.1.0.02,7]heptane (CID 45079181) is 1-prop-1-ynyltricyclo[4.1.0.02,7]heptane.
What is the SMILES notation for 1-prop-1-ynyltricyclo[4.1.0.02,7]heptane?
The canonical SMILES for 1-prop-1-ynyltricyclo[4.1.0.02,7]heptane is CC#CC12C3CCCC1C32.
What is the InChIKey of 1-prop-1-ynyltricyclo[4.1.0.02,7]heptane?
The InChIKey is ZCEXWVNICHUBNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12/c1-2-6-10-7-4-3-5-8(10)9(7)10/h7-9H,3-5H2,1H3.
What are the key properties of 1-prop-1-ynyltricyclo[4.1.0.02,7]heptane?
1-prop-1-ynyltricyclo[4.1.0.02,7]heptane has a molecular weight of 132.21 g/mol, XLogP of 2.06, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-1-ynyltricyclo[4.1.0.02,7]heptane is sourced from PubChem (CID 45079181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).