About 2,6-diethynylpiperazine
2,6-diethynylpiperazine (PubChem CID 45079231) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 2,6-diethynylpiperazine.
Molecular Properties
| Compound Name | 2,6-diethynylpiperazine |
| PubChem CID | 45079231 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 2,6-diethynylpiperazine |
| SMILES | C#CC1CNCC(C#C)N1 |
| InChI | InChI=1S/C8H10N2/c1-3-7-5-9-6-8(4-2)10-7/h1-2,7-10H,5-6H2 |
| InChIKey | HJPIGJUVOQAPPF-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,6-diethynylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diethynylpiperazine?
The IUPAC name of 2,6-diethynylpiperazine (CID 45079231) is 2,6-diethynylpiperazine.
What is the SMILES notation for 2,6-diethynylpiperazine?
The canonical SMILES for 2,6-diethynylpiperazine is C#CC1CNCC(C#C)N1.
What is the InChIKey of 2,6-diethynylpiperazine?
The InChIKey is HJPIGJUVOQAPPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-3-7-5-9-6-8(4-2)10-7/h1-2,7-10H,5-6H2.
What are the key properties of 2,6-diethynylpiperazine?
2,6-diethynylpiperazine has a molecular weight of 134.18 g/mol, XLogP of -0.82, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diethynylpiperazine is sourced from PubChem (CID 45079231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).