About 5-ethynyl-1,3-dimethylpyrazol-4-amine
5-ethynyl-1,3-dimethylpyrazol-4-amine (PubChem CID 45079261) has the molecular formula C7H9N3
and a molecular weight of 135.17 g/mol. Its IUPAC name is 5-ethynyl-1,3-dimethylpyrazol-4-amine.
Molecular Properties
| Compound Name | 5-ethynyl-1,3-dimethylpyrazol-4-amine |
| PubChem CID | 45079261 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 5-ethynyl-1,3-dimethylpyrazol-4-amine |
| SMILES | C#Cc1c(N)c(C)nn1C |
| InChI | InChI=1S/C7H9N3/c1-4-6-7(8)5(2)9-10(6)3/h1H,8H2,2-3H3 |
| InChIKey | GLWROZXRTBXSTP-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethynyl-1,3-dimethylpyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethynyl-1,3-dimethylpyrazol-4-amine?
The IUPAC name of 5-ethynyl-1,3-dimethylpyrazol-4-amine (CID 45079261) is 5-ethynyl-1,3-dimethylpyrazol-4-amine.
What is the SMILES notation for 5-ethynyl-1,3-dimethylpyrazol-4-amine?
The canonical SMILES for 5-ethynyl-1,3-dimethylpyrazol-4-amine is C#Cc1c(N)c(C)nn1C.
What is the InChIKey of 5-ethynyl-1,3-dimethylpyrazol-4-amine?
The InChIKey is GLWROZXRTBXSTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3/c1-4-6-7(8)5(2)9-10(6)3/h1H,8H2,2-3H3.
What are the key properties of 5-ethynyl-1,3-dimethylpyrazol-4-amine?
5-ethynyl-1,3-dimethylpyrazol-4-amine has a molecular weight of 135.17 g/mol, XLogP of 0.29, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethynyl-1,3-dimethylpyrazol-4-amine is sourced from PubChem (CID 45079261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).