About 7H-isoquinolin-1-one
7H-isoquinolin-1-one (PubChem CID 45079456) has the molecular formula C9H7NO
and a molecular weight of 145.16 g/mol. Its IUPAC name is 7H-isoquinolin-1-one.
Molecular Properties
| Compound Name | 7H-isoquinolin-1-one |
| PubChem CID | 45079456 |
| Molecular Formula | C9H7NO |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.05 |
| IUPAC Name | 7H-isoquinolin-1-one |
| SMILES | O=C1N=CC=C2C=CCC=C12 |
| InChI | InChI=1S/C9H7NO/c11-9-8-4-2-1-3-7(8)5-6-10-9/h1,3-6H,2H2 |
| InChIKey | HJLMAIQISHSIJF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7H-isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-isoquinolin-1-one?
The IUPAC name of 7H-isoquinolin-1-one (CID 45079456) is 7H-isoquinolin-1-one.
What is the SMILES notation for 7H-isoquinolin-1-one?
The canonical SMILES for 7H-isoquinolin-1-one is O=C1N=CC=C2C=CCC=C12.
What is the InChIKey of 7H-isoquinolin-1-one?
The InChIKey is HJLMAIQISHSIJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO/c11-9-8-4-2-1-3-7(8)5-6-10-9/h1,3-6H,2H2.
What are the key properties of 7H-isoquinolin-1-one?
7H-isoquinolin-1-one has a molecular weight of 145.16 g/mol, XLogP of 1.41, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-isoquinolin-1-one is sourced from PubChem (CID 45079456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).