About 6-methyl-1,5-dihydroimidazo[4,5-c]pyridin-4-one
6-methyl-1,5-dihydroimidazo[4,5-c]pyridin-4-one (PubChem CID 45079524) has the molecular formula C7H7N3O
and a molecular weight of 149.15 g/mol. Its IUPAC name is 6-methyl-1,5-dihydroimidazo[4,5-c]pyridin-4-one.
Molecular Properties
| Compound Name | 6-methyl-1,5-dihydroimidazo[4,5-c]pyridin-4-one |
| PubChem CID | 45079524 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 6-methyl-1,5-dihydroimidazo[4,5-c]pyridin-4-one |
| SMILES | Cc1cc2[nH]cnc2c(=O)[nH]1 |
| InChI | InChI=1S/C7H7N3O/c1-4-2-5-6(7(11)10-4)9-3-8-5/h2-3H,1H3,(H,8,9)(H,10,11) |
| InChIKey | QSPZFJAQUCGJJI-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-1,5-dihydroimidazo[4,5-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1,5-dihydroimidazo[4,5-c]pyridin-4-one?
The IUPAC name of 6-methyl-1,5-dihydroimidazo[4,5-c]pyridin-4-one (CID 45079524) is 6-methyl-1,5-dihydroimidazo[4,5-c]pyridin-4-one.
What is the SMILES notation for 6-methyl-1,5-dihydroimidazo[4,5-c]pyridin-4-one?
The canonical SMILES for 6-methyl-1,5-dihydroimidazo[4,5-c]pyridin-4-one is Cc1cc2[nH]cnc2c(=O)[nH]1.
What is the InChIKey of 6-methyl-1,5-dihydroimidazo[4,5-c]pyridin-4-one?
The InChIKey is QSPZFJAQUCGJJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O/c1-4-2-5-6(7(11)10-4)9-3-8-5/h2-3H,1H3,(H,8,9)(H,10,11).
What are the key properties of 6-methyl-1,5-dihydroimidazo[4,5-c]pyridin-4-one?
6-methyl-1,5-dihydroimidazo[4,5-c]pyridin-4-one has a molecular weight of 149.15 g/mol, XLogP of 0.56, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1,5-dihydroimidazo[4,5-c]pyridin-4-one is sourced from PubChem (CID 45079524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).