About 1H-pyrido[4,3-c]thiazine
1H-pyrido[4,3-c]thiazine (PubChem CID 45079588) has the molecular formula C7H6N2S
and a molecular weight of 150.21 g/mol. Its IUPAC name is 1H-pyrido[4,3-c]thiazine.
Molecular Properties
| Compound Name | 1H-pyrido[4,3-c]thiazine |
| PubChem CID | 45079588 |
| Molecular Formula | C7H6N2S |
| Molecular Weight | 150.21 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | 1H-pyrido[4,3-c]thiazine |
| SMILES | C1=Cc2cnccc2NS1 |
| InChI | InChI=1S/C7H6N2S/c1-3-8-5-6-2-4-10-9-7(1)6/h1-5,9H |
| InChIKey | AXQQVYHZHBOKEZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyrido[4,3-c]thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrido[4,3-c]thiazine?
The IUPAC name of 1H-pyrido[4,3-c]thiazine (CID 45079588) is 1H-pyrido[4,3-c]thiazine.
What is the SMILES notation for 1H-pyrido[4,3-c]thiazine?
The canonical SMILES for 1H-pyrido[4,3-c]thiazine is C1=Cc2cnccc2NS1.
What is the InChIKey of 1H-pyrido[4,3-c]thiazine?
The InChIKey is AXQQVYHZHBOKEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2S/c1-3-8-5-6-2-4-10-9-7(1)6/h1-5,9H.
What are the key properties of 1H-pyrido[4,3-c]thiazine?
1H-pyrido[4,3-c]thiazine has a molecular weight of 150.21 g/mol, XLogP of 2.13, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrido[4,3-c]thiazine is sourced from PubChem (CID 45079588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).