About 4-methyl-2,7-naphthyridine
4-methyl-2,7-naphthyridine (PubChem CID 45079668) has the molecular formula C9H8N2
and a molecular weight of 144.18 g/mol. Its IUPAC name is 4-methyl-2,7-naphthyridine.
Molecular Properties
| Compound Name | 4-methyl-2,7-naphthyridine |
| PubChem CID | 45079668 |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 4-methyl-2,7-naphthyridine |
| SMILES | Cc1cncc2cnccc12 |
| InChI | InChI=1S/C9H8N2/c1-7-4-11-6-8-5-10-3-2-9(7)8/h2-6H,1H3 |
| InChIKey | ZOUQPHQOJNSPAH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-2,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,7-naphthyridine?
The IUPAC name of 4-methyl-2,7-naphthyridine (CID 45079668) is 4-methyl-2,7-naphthyridine.
What is the SMILES notation for 4-methyl-2,7-naphthyridine?
The canonical SMILES for 4-methyl-2,7-naphthyridine is Cc1cncc2cnccc12.
What is the InChIKey of 4-methyl-2,7-naphthyridine?
The InChIKey is ZOUQPHQOJNSPAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2/c1-7-4-11-6-8-5-10-3-2-9(7)8/h2-6H,1H3.
What are the key properties of 4-methyl-2,7-naphthyridine?
4-methyl-2,7-naphthyridine has a molecular weight of 144.18 g/mol, XLogP of 1.94, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,7-naphthyridine is sourced from PubChem (CID 45079668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).