About 5-(furan-3-yl)pyrimidine
5-(furan-3-yl)pyrimidine (PubChem CID 45080069) has the molecular formula C8H6N2O
and a molecular weight of 146.15 g/mol. Its IUPAC name is 5-(furan-3-yl)pyrimidine.
Molecular Properties
| Compound Name | 5-(furan-3-yl)pyrimidine |
| PubChem CID | 45080069 |
| Molecular Formula | C8H6N2O |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | 5-(furan-3-yl)pyrimidine |
| SMILES | c1ncc(-c2ccoc2)cn1 |
| InChI | InChI=1S/C8H6N2O/c1-2-11-5-7(1)8-3-9-6-10-4-8/h1-6H |
| InChIKey | ZSSGSLKYCKZXOD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(furan-3-yl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(furan-3-yl)pyrimidine?
The IUPAC name of 5-(furan-3-yl)pyrimidine (CID 45080069) is 5-(furan-3-yl)pyrimidine.
What is the SMILES notation for 5-(furan-3-yl)pyrimidine?
The canonical SMILES for 5-(furan-3-yl)pyrimidine is c1ncc(-c2ccoc2)cn1.
What is the InChIKey of 5-(furan-3-yl)pyrimidine?
The InChIKey is ZSSGSLKYCKZXOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O/c1-2-11-5-7(1)8-3-9-6-10-4-8/h1-6H.
What are the key properties of 5-(furan-3-yl)pyrimidine?
5-(furan-3-yl)pyrimidine has a molecular weight of 146.15 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(furan-3-yl)pyrimidine is sourced from PubChem (CID 45080069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).