About 6H-pyrimido[5,4-c]azepine
6H-pyrimido[5,4-c]azepine (PubChem CID 45080176) has the molecular formula C8H7N3
and a molecular weight of 145.16 g/mol. Its IUPAC name is 6H-pyrimido[5,4-c]azepine.
Molecular Properties
| Compound Name | 6H-pyrimido[5,4-c]azepine |
| PubChem CID | 45080176 |
| Molecular Formula | C8H7N3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | 6H-pyrimido[5,4-c]azepine |
| SMILES | C1=CNC=c2cncnc2=C1 |
| InChI | InChI=1S/C8H7N3/c1-2-8-7(4-9-3-1)5-10-6-11-8/h1-6,9H |
| InChIKey | WJOUHRVVWOCGCT-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6H-pyrimido[5,4-c]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-pyrimido[5,4-c]azepine?
The IUPAC name of 6H-pyrimido[5,4-c]azepine (CID 45080176) is 6H-pyrimido[5,4-c]azepine.
What is the SMILES notation for 6H-pyrimido[5,4-c]azepine?
The canonical SMILES for 6H-pyrimido[5,4-c]azepine is C1=CNC=c2cncnc2=C1.
What is the InChIKey of 6H-pyrimido[5,4-c]azepine?
The InChIKey is WJOUHRVVWOCGCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3/c1-2-8-7(4-9-3-1)5-10-6-11-8/h1-6,9H.
What are the key properties of 6H-pyrimido[5,4-c]azepine?
6H-pyrimido[5,4-c]azepine has a molecular weight of 145.16 g/mol, XLogP of -0.89, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-pyrimido[5,4-c]azepine is sourced from PubChem (CID 45080176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).