C8H7N3 — CID 45080354
9H-pyrimido[4,5-b]azepine (PubChem CID 45080354) has the molecular formula C8H7N3 and a molecular weight of 145.16 g/mol. Its IUPAC name is 9H-pyrimido[4,5-b]azepine.
| Compound Name | 9H-pyrimido[4,5-b]azepine |
|---|---|
| PubChem CID | 45080354 |
| Molecular Formula | C8H7N3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | 9H-pyrimido[4,5-b]azepine |
| SMILES | C1=CNc2ncncc2C=C1 |
| InChI | InChI=1S/C8H7N3/c1-2-4-10-8-7(3-1)5-9-6-11-8/h1-6H,(H,9,10,11) |
| InChIKey | PCPILDOZXKKWOH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |