About 7H-pyrimido[4,5-b][1,4]oxazine
7H-pyrimido[4,5-b][1,4]oxazine (PubChem CID 45080409) has the molecular formula C6H5N3O
and a molecular weight of 135.13 g/mol. Its IUPAC name is 7H-pyrimido[4,5-b][1,4]oxazine.
Molecular Properties
| Compound Name | 7H-pyrimido[4,5-b][1,4]oxazine |
| PubChem CID | 45080409 |
| Molecular Formula | C6H5N3O |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | 7H-pyrimido[4,5-b][1,4]oxazine |
| SMILES | C1=Nc2cncnc2OC1 |
| InChI | InChI=1S/C6H5N3O/c1-2-10-6-5(8-1)3-7-4-9-6/h1,3-4H,2H2 |
| InChIKey | DDMHQMXOMBWJQJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 47.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7H-pyrimido[4,5-b][1,4]oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-pyrimido[4,5-b][1,4]oxazine?
The IUPAC name of 7H-pyrimido[4,5-b][1,4]oxazine (CID 45080409) is 7H-pyrimido[4,5-b][1,4]oxazine.
What is the SMILES notation for 7H-pyrimido[4,5-b][1,4]oxazine?
The canonical SMILES for 7H-pyrimido[4,5-b][1,4]oxazine is C1=Nc2cncnc2OC1.
What is the InChIKey of 7H-pyrimido[4,5-b][1,4]oxazine?
The InChIKey is DDMHQMXOMBWJQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O/c1-2-10-6-5(8-1)3-7-4-9-6/h1,3-4H,2H2.
What are the key properties of 7H-pyrimido[4,5-b][1,4]oxazine?
7H-pyrimido[4,5-b][1,4]oxazine has a molecular weight of 135.13 g/mol, XLogP of 0.57, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-pyrimido[4,5-b][1,4]oxazine is sourced from PubChem (CID 45080409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).