About 1,4-dihydropteridine
1,4-dihydropteridine (PubChem CID 45080412) has the molecular formula C6H6N4
and a molecular weight of 134.14 g/mol. Its IUPAC name is 1,4-dihydropteridine.
Molecular Properties
| Compound Name | 1,4-dihydropteridine |
| PubChem CID | 45080412 |
| Molecular Formula | C6H6N4 |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | 1,4-dihydropteridine |
| SMILES | C1=NCc2nccnc2N1 |
| InChI | InChI=1S/C6H6N4/c1-2-9-6-5(8-1)3-7-4-10-6/h1-2,4H,3H2,(H,7,9,10) |
| InChIKey | JBNBYKWDFWNCFV-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,4-dihydropteridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dihydropteridine?
The IUPAC name of 1,4-dihydropteridine (CID 45080412) is 1,4-dihydropteridine.
What is the SMILES notation for 1,4-dihydropteridine?
The canonical SMILES for 1,4-dihydropteridine is C1=NCc2nccnc2N1.
What is the InChIKey of 1,4-dihydropteridine?
The InChIKey is JBNBYKWDFWNCFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4/c1-2-9-6-5(8-1)3-7-4-10-6/h1-2,4H,3H2,(H,7,9,10).
What are the key properties of 1,4-dihydropteridine?
1,4-dihydropteridine has a molecular weight of 134.14 g/mol, XLogP of 0.43, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dihydropteridine is sourced from PubChem (CID 45080412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).