About 2,7-dimethyl-5,6-dihydropyrrolo[2,3-d]pyrimidine
2,7-dimethyl-5,6-dihydropyrrolo[2,3-d]pyrimidine (PubChem CID 45080430) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is 2,7-dimethyl-5,6-dihydropyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 2,7-dimethyl-5,6-dihydropyrrolo[2,3-d]pyrimidine |
| PubChem CID | 45080430 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 2,7-dimethyl-5,6-dihydropyrrolo[2,3-d]pyrimidine |
| SMILES | Cc1ncc2c(n1)N(C)CC2 |
| InChI | InChI=1S/C8H11N3/c1-6-9-5-7-3-4-11(2)8(7)10-6/h5H,3-4H2,1-2H3 |
| InChIKey | VUVQIXHSVAVQFN-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,7-dimethyl-5,6-dihydropyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethyl-5,6-dihydropyrrolo[2,3-d]pyrimidine?
The IUPAC name of 2,7-dimethyl-5,6-dihydropyrrolo[2,3-d]pyrimidine (CID 45080430) is 2,7-dimethyl-5,6-dihydropyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 2,7-dimethyl-5,6-dihydropyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 2,7-dimethyl-5,6-dihydropyrrolo[2,3-d]pyrimidine is Cc1ncc2c(n1)N(C)CC2.
What is the InChIKey of 2,7-dimethyl-5,6-dihydropyrrolo[2,3-d]pyrimidine?
The InChIKey is VUVQIXHSVAVQFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3/c1-6-9-5-7-3-4-11(2)8(7)10-6/h5H,3-4H2,1-2H3.
What are the key properties of 2,7-dimethyl-5,6-dihydropyrrolo[2,3-d]pyrimidine?
2,7-dimethyl-5,6-dihydropyrrolo[2,3-d]pyrimidine has a molecular weight of 149.20 g/mol, XLogP of 0.78, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethyl-5,6-dihydropyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 45080430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).