About thiadiazolo[5,4-d]pyrimidine
thiadiazolo[5,4-d]pyrimidine (PubChem CID 45080540) has the molecular formula C4H2N4S
and a molecular weight of 138.16 g/mol. Its IUPAC name is thiadiazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | thiadiazolo[5,4-d]pyrimidine |
| PubChem CID | 45080540 |
| Molecular Formula | C4H2N4S |
| Molecular Weight | 138.16 g/mol |
| Exact Mass | 138.00 |
| IUPAC Name | thiadiazolo[5,4-d]pyrimidine |
| SMILES | c1ncc2nnsc2n1 |
| InChI | InChI=1S/C4H2N4S/c1-3-4(6-2-5-1)9-8-7-3/h1-2H |
| InChIKey | PWVGMQFTWJTCNG-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.16 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze thiadiazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiadiazolo[5,4-d]pyrimidine?
The IUPAC name of thiadiazolo[5,4-d]pyrimidine (CID 45080540) is thiadiazolo[5,4-d]pyrimidine.
What is the SMILES notation for thiadiazolo[5,4-d]pyrimidine?
The canonical SMILES for thiadiazolo[5,4-d]pyrimidine is c1ncc2nnsc2n1.
What is the InChIKey of thiadiazolo[5,4-d]pyrimidine?
The InChIKey is PWVGMQFTWJTCNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2N4S/c1-3-4(6-2-5-1)9-8-7-3/h1-2H.
What are the key properties of thiadiazolo[5,4-d]pyrimidine?
thiadiazolo[5,4-d]pyrimidine has a molecular weight of 138.16 g/mol, XLogP of 0.48, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for thiadiazolo[5,4-d]pyrimidine is sourced from PubChem (CID 45080540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).