C8H14BrNO — CID 45080682
2-bromo-1-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]ethanone (PubChem CID 45080682) has the molecular formula C8H14BrNO and a molecular weight of 220.11 g/mol. Its IUPAC name is 2-bromo-1-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]ethanone.
| Compound Name | 2-bromo-1-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 45080682 |
| Molecular Formula | C8H14BrNO |
| Molecular Weight | 220.11 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | 2-bromo-1-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]ethanone |
| SMILES | C[C@@H]1CC[C@@H](C)N1C(=O)CBr |
| InChI | InChI=1S/C8H14BrNO/c1-6-3-4-7(2)10(6)8(11)5-9/h6-7H,3-5H2,1-2H3/t6-,7-/m1/s1 |
| InChIKey | UQZVNTZQPMYZPS-RNFRBKRXSA-N |
| XLogP | 1.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.11 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|