About (2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carbonitrile
(2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carbonitrile (PubChem CID 45080890) has the molecular formula C7H7F3N2O
and a molecular weight of 192.14 g/mol. Its IUPAC name is (2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carbonitrile.
Molecular Properties
| Compound Name | (2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carbonitrile |
| PubChem CID | 45080890 |
| Molecular Formula | C7H7F3N2O |
| Molecular Weight | 192.14 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | (2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carbonitrile |
| SMILES | N#C[C@@H]1CCCN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C7H7F3N2O/c8-7(9,10)6(13)12-3-1-2-5(12)4-11/h5H,1-3H2/t5-/m0/s1 |
| InChIKey | UAIMQUFKCWDSSH-YFKPBYRVSA-N |
| XLogP | 1.06 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.14 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carbonitrile?
The IUPAC name of (2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carbonitrile (CID 45080890) is (2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carbonitrile.
What is the SMILES notation for (2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carbonitrile?
The canonical SMILES for (2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carbonitrile is N#C[C@@H]1CCCN1C(=O)C(F)(F)F.
What is the InChIKey of (2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carbonitrile?
The InChIKey is UAIMQUFKCWDSSH-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H7F3N2O/c8-7(9,10)6(13)12-3-1-2-5(12)4-11/h5H,1-3H2/t5-/m0/s1.
What are the key properties of (2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carbonitrile?
(2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carbonitrile has a molecular weight of 192.14 g/mol, XLogP of 1.06, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carbonitrile is sourced from PubChem (CID 45080890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).