C10H16ClNO — CID 45080975
2-chloro-1-(2,2,5,5-tetramethylpyrrol-1-yl)ethanone (PubChem CID 45080975) has the molecular formula C10H16ClNO and a molecular weight of 201.70 g/mol. Its IUPAC name is 2-chloro-1-(2,2,5,5-tetramethylpyrrol-1-yl)ethanone.
| Compound Name | 2-chloro-1-(2,2,5,5-tetramethylpyrrol-1-yl)ethanone |
|---|---|
| PubChem CID | 45080975 |
| Molecular Formula | C10H16ClNO |
| Molecular Weight | 201.70 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 2-chloro-1-(2,2,5,5-tetramethylpyrrol-1-yl)ethanone |
| SMILES | CC1(C)C=CC(C)(C)N1C(=O)CCl |
| InChI | InChI=1S/C10H16ClNO/c1-9(2)5-6-10(3,4)12(9)8(13)7-11/h5-6H,7H2,1-4H3 |
| InChIKey | JHCJFCYTMUKOBD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.70 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|