C6H5ClN2O4 — CID 45080983
5-(2-chloroacetyl)-1,3-diazinane-2,4,6-trione (PubChem CID 45080983) has the molecular formula C6H5ClN2O4 and a molecular weight of 204.57 g/mol. Its IUPAC name is 5-(2-chloroacetyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(2-chloroacetyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 45080983 |
| Molecular Formula | C6H5ClN2O4 |
| Molecular Weight | 204.57 g/mol |
| Exact Mass | 203.99 |
| IUPAC Name | 5-(2-chloroacetyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(C(=O)CCl)C(=O)N1 |
| InChI | InChI=1S/C6H5ClN2O4/c7-1-2(10)3-4(11)8-6(13)9-5(3)12/h3H,1H2,(H2,8,9,11,12,13) |
| InChIKey | XXXZMKFHJANJKK-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.57 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|