C10H12F3NO — CID 45081189
1-(1-tert-butylpyrrol-3-yl)-2,2,2-trifluoroethanone (PubChem CID 45081189) has the molecular formula C10H12F3NO and a molecular weight of 219.21 g/mol. Its IUPAC name is 1-(1-tert-butylpyrrol-3-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(1-tert-butylpyrrol-3-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 45081189 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 1-(1-tert-butylpyrrol-3-yl)-2,2,2-trifluoroethanone |
| SMILES | CC(C)(C)n1ccc(C(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H12F3NO/c1-9(2,3)14-5-4-7(6-14)8(15)10(11,12)13/h4-6H,1-3H3 |
| InChIKey | OIUNBHOGUYOFBC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |