C10H15ClO3 — CID 45081202
trans-methyl (1R,2R)-2-(2-chloroacetyl)cyclohexane-1-carboxylate (PubChem CID 45081202) has the molecular formula C10H15ClO3 and a molecular weight of 218.68 g/mol. Its IUPAC name is trans-methyl (1R,2R)-2-(2-chloroacetyl)cyclohexane-1-carboxylate.
| Compound Name | trans-methyl (1R,2R)-2-(2-chloroacetyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 45081202 |
| Molecular Formula | C10H15ClO3 |
| Molecular Weight | 218.68 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | trans-methyl (1R,2R)-2-(2-chloroacetyl)cyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCC[C@H]1C(=O)CCl |
| InChI | InChI=1S/C10H15ClO3/c1-14-10(13)8-5-3-2-4-7(8)9(12)6-11/h7-8H,2-6H2,1H3/t7-,8-/m1/s1 |
| InChIKey | FFDVICGBVSJEGY-HTQZYQBOSA-N |
| XLogP | 1.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.68 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|