bicyclo[2.2.2]octane-1-carbonyl fluoride

C9H13FO — CID 45081305

IUPACbicyclo[2.2.2]octane-1-carbonyl fluoride
SMILESO=C(F)C12CCC(CC1)CC2
InChIInChI=1S/C9H13FO/c10-8(11)9-4-1-7(2-5-9)3-6-9/h7H,1-6H2
InChIKeyQRXGPWZIBNQHQC-UHFFFAOYSA-N
MW156.20 g/mol
LogP2.45
Rot. Bonds1

About bicyclo[2.2.2]octane-1-carbonyl fluoride

bicyclo[2.2.2]octane-1-carbonyl fluoride (PubChem CID 45081305) has the molecular formula C9H13FO and a molecular weight of 156.20 g/mol. Its IUPAC name is bicyclo[2.2.2]octane-1-carbonyl fluoride.

Molecular Properties

Compound Namebicyclo[2.2.2]octane-1-carbonyl fluoride
PubChem CID45081305
Molecular FormulaC9H13FO
Molecular Weight156.20 g/mol
Exact Mass156.10
IUPAC Namebicyclo[2.2.2]octane-1-carbonyl fluoride
SMILESO=C(F)C12CCC(CC1)CC2
InChIInChI=1S/C9H13FO/c10-8(11)9-4-1-7(2-5-9)3-6-9/h7H,1-6H2
InChIKeyQRXGPWZIBNQHQC-UHFFFAOYSA-N
XLogP2.45
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.20
LogP ≤ 52.45
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze bicyclo[2.2.2]octane-1-carbonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bicyclo[2.2.2]octane-1-carbonyl fluoride?
The IUPAC name of bicyclo[2.2.2]octane-1-carbonyl fluoride (CID 45081305) is bicyclo[2.2.2]octane-1-carbonyl fluoride.
What is the SMILES notation for bicyclo[2.2.2]octane-1-carbonyl fluoride?
The canonical SMILES for bicyclo[2.2.2]octane-1-carbonyl fluoride is O=C(F)C12CCC(CC1)CC2.
What is the InChIKey of bicyclo[2.2.2]octane-1-carbonyl fluoride?
The InChIKey is QRXGPWZIBNQHQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13FO/c10-8(11)9-4-1-7(2-5-9)3-6-9/h7H,1-6H2.
What are the key properties of bicyclo[2.2.2]octane-1-carbonyl fluoride?
bicyclo[2.2.2]octane-1-carbonyl fluoride has a molecular weight of 156.20 g/mol, XLogP of 2.45, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.2]octane-1-carbonyl fluoride is sourced from PubChem (CID 45081305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).