5-methoxy-1,2-oxazole-3-carbonyl chloride

C5H4ClNO3 — CID 45081381

IUPAC5-methoxy-1,2-oxazole-3-carbonyl chloride
SMILESCOc1cc(C(=O)Cl)no1
InChIInChI=1S/C5H4ClNO3/c1-9-4-2-3(5(6)8)7-10-4/h2H,1H3
InChIKeyYFNWZAZTHKHBEY-UHFFFAOYSA-N
MW161.54 g/mol
LogP1.06
Rot. Bonds2

About 5-methoxy-1,2-oxazole-3-carbonyl chloride

5-methoxy-1,2-oxazole-3-carbonyl chloride (PubChem CID 45081381) has the molecular formula C5H4ClNO3 and a molecular weight of 161.54 g/mol. Its IUPAC name is 5-methoxy-1,2-oxazole-3-carbonyl chloride.

Molecular Properties

Compound Name5-methoxy-1,2-oxazole-3-carbonyl chloride
PubChem CID45081381
Molecular FormulaC5H4ClNO3
Molecular Weight161.54 g/mol
Exact Mass160.99
IUPAC Name5-methoxy-1,2-oxazole-3-carbonyl chloride
SMILESCOc1cc(C(=O)Cl)no1
InChIInChI=1S/C5H4ClNO3/c1-9-4-2-3(5(6)8)7-10-4/h2H,1H3
InChIKeyYFNWZAZTHKHBEY-UHFFFAOYSA-N
XLogP1.06
TPSA52.33 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500161.54
LogP ≤ 51.06
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 5-methoxy-1,2-oxazole-3-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methoxy-1,2-oxazole-3-carbonyl chloride?
The IUPAC name of 5-methoxy-1,2-oxazole-3-carbonyl chloride (CID 45081381) is 5-methoxy-1,2-oxazole-3-carbonyl chloride.
What is the SMILES notation for 5-methoxy-1,2-oxazole-3-carbonyl chloride?
The canonical SMILES for 5-methoxy-1,2-oxazole-3-carbonyl chloride is COc1cc(C(=O)Cl)no1.
What is the InChIKey of 5-methoxy-1,2-oxazole-3-carbonyl chloride?
The InChIKey is YFNWZAZTHKHBEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4ClNO3/c1-9-4-2-3(5(6)8)7-10-4/h2H,1H3.
What are the key properties of 5-methoxy-1,2-oxazole-3-carbonyl chloride?
5-methoxy-1,2-oxazole-3-carbonyl chloride has a molecular weight of 161.54 g/mol, XLogP of 1.06, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1,2-oxazole-3-carbonyl chloride is sourced from PubChem (CID 45081381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).