C9H9ClO — CID 45081414
bicyclo[5.1.0]octa-2,4-diene-8-carbonyl chloride (PubChem CID 45081414) has the molecular formula C9H9ClO and a molecular weight of 168.62 g/mol. Its IUPAC name is bicyclo[5.1.0]octa-2,4-diene-8-carbonyl chloride.
| Compound Name | bicyclo[5.1.0]octa-2,4-diene-8-carbonyl chloride |
|---|---|
| PubChem CID | 45081414 |
| Molecular Formula | C9H9ClO |
| Molecular Weight | 168.62 g/mol |
| Exact Mass | 168.03 |
| IUPAC Name | bicyclo[5.1.0]octa-2,4-diene-8-carbonyl chloride |
| SMILES | O=C(Cl)C1C2C=CC=CCC21 |
| InChI | InChI=1S/C9H9ClO/c10-9(11)8-6-4-2-1-3-5-7(6)8/h1-4,6-8H,5H2 |
| InChIKey | IZJAMHAPQKAYDB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.62 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|