C10H13ClO — CID 45081571
(1S,2S,3R,4R)-3-methylbicyclo[2.2.2]oct-5-ene-2-carbonyl chloride (PubChem CID 45081571) has the molecular formula C10H13ClO and a molecular weight of 184.67 g/mol. Its IUPAC name is (1S,2S,3R,4R)-3-methylbicyclo[2.2.2]oct-5-ene-2-carbonyl chloride.
| Compound Name | (1S,2S,3R,4R)-3-methylbicyclo[2.2.2]oct-5-ene-2-carbonyl chloride |
|---|---|
| PubChem CID | 45081571 |
| Molecular Formula | C10H13ClO |
| Molecular Weight | 184.67 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (1S,2S,3R,4R)-3-methylbicyclo[2.2.2]oct-5-ene-2-carbonyl chloride |
| SMILES | C[C@H]1[C@H](C(=O)Cl)[C@@H]2C=C[C@H]1CC2 |
| InChI | InChI=1S/C10H13ClO/c1-6-7-2-4-8(5-3-7)9(6)10(11)12/h2,4,6-9H,3,5H2,1H3/t6-,7+,8-,9+/m1/s1 |
| InChIKey | ZZTYIIXNFXFZFP-XAVMHZPKSA-N |
| XLogP | 2.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.67 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|