About 4-cyano-3-methoxybenzoyl chloride
4-cyano-3-methoxybenzoyl chloride (PubChem CID 45081742) has the molecular formula C9H6ClNO2
and a molecular weight of 195.60 g/mol. Its IUPAC name is 4-cyano-3-methoxybenzoyl chloride.
Molecular Properties
| Compound Name | 4-cyano-3-methoxybenzoyl chloride |
| PubChem CID | 45081742 |
| Molecular Formula | C9H6ClNO2 |
| Molecular Weight | 195.60 g/mol |
| Exact Mass | 195.01 |
| IUPAC Name | 4-cyano-3-methoxybenzoyl chloride |
| SMILES | COc1cc(C(=O)Cl)ccc1C#N |
| InChI | InChI=1S/C9H6ClNO2/c1-13-8-4-6(9(10)12)2-3-7(8)5-11/h2-4H,1H3 |
| InChIKey | TYAARUJSFKNGCV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.60 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-cyano-3-methoxybenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-3-methoxybenzoyl chloride?
The IUPAC name of 4-cyano-3-methoxybenzoyl chloride (CID 45081742) is 4-cyano-3-methoxybenzoyl chloride.
What is the SMILES notation for 4-cyano-3-methoxybenzoyl chloride?
The canonical SMILES for 4-cyano-3-methoxybenzoyl chloride is COc1cc(C(=O)Cl)ccc1C#N.
What is the InChIKey of 4-cyano-3-methoxybenzoyl chloride?
The InChIKey is TYAARUJSFKNGCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClNO2/c1-13-8-4-6(9(10)12)2-3-7(8)5-11/h2-4H,1H3.
What are the key properties of 4-cyano-3-methoxybenzoyl chloride?
4-cyano-3-methoxybenzoyl chloride has a molecular weight of 195.60 g/mol, XLogP of 1.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-3-methoxybenzoyl chloride is sourced from PubChem (CID 45081742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).