C9H8ClN3O — CID 45081942
1,3-dimethylpyrazolo[5,4-b]pyridine-5-carbonyl chloride (PubChem CID 45081942) has the molecular formula C9H8ClN3O and a molecular weight of 209.64 g/mol. Its IUPAC name is 1,3-dimethylpyrazolo[5,4-b]pyridine-5-carbonyl chloride.
| Compound Name | 1,3-dimethylpyrazolo[5,4-b]pyridine-5-carbonyl chloride |
|---|---|
| PubChem CID | 45081942 |
| Molecular Formula | C9H8ClN3O |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 1,3-dimethylpyrazolo[5,4-b]pyridine-5-carbonyl chloride |
| SMILES | Cc1nn(C)c2ncc(C(=O)Cl)cc12 |
| InChI | InChI=1S/C9H8ClN3O/c1-5-7-3-6(8(10)14)4-11-9(7)13(2)12-5/h3-4H,1-2H3 |
| InChIKey | BPYULXLPWORSAF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|