1,3-dimethylpyrazolo[5,4-b]pyridine-5-carbonyl chloride

C9H8ClN3O — CID 45081942

IUPAC1,3-dimethylpyrazolo[5,4-b]pyridine-5-carbonyl chloride
SMILESCc1nn(C)c2ncc(C(=O)Cl)cc12
InChIInChI=1S/C9H8ClN3O/c1-5-7-3-6(8(10)14)4-11-9(7)13(2)12-5/h3-4H,1-2H3
InChIKeyBPYULXLPWORSAF-UHFFFAOYSA-N
MW209.64 g/mol
LogP1.66
Rot. Bonds1

About 1,3-dimethylpyrazolo[5,4-b]pyridine-5-carbonyl chloride

1,3-dimethylpyrazolo[5,4-b]pyridine-5-carbonyl chloride (PubChem CID 45081942) has the molecular formula C9H8ClN3O and a molecular weight of 209.64 g/mol. Its IUPAC name is 1,3-dimethylpyrazolo[5,4-b]pyridine-5-carbonyl chloride.

Molecular Properties

Compound Name1,3-dimethylpyrazolo[5,4-b]pyridine-5-carbonyl chloride
PubChem CID45081942
Molecular FormulaC9H8ClN3O
Molecular Weight209.64 g/mol
Exact Mass209.04
IUPAC Name1,3-dimethylpyrazolo[5,4-b]pyridine-5-carbonyl chloride
SMILESCc1nn(C)c2ncc(C(=O)Cl)cc12
InChIInChI=1S/C9H8ClN3O/c1-5-7-3-6(8(10)14)4-11-9(7)13(2)12-5/h3-4H,1-2H3
InChIKeyBPYULXLPWORSAF-UHFFFAOYSA-N
XLogP1.66
TPSA47.78 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.64
LogP ≤ 51.66
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 1,3-dimethylpyrazolo[5,4-b]pyridine-5-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-dimethylpyrazolo[5,4-b]pyridine-5-carbonyl chloride?
The IUPAC name of 1,3-dimethylpyrazolo[5,4-b]pyridine-5-carbonyl chloride (CID 45081942) is 1,3-dimethylpyrazolo[5,4-b]pyridine-5-carbonyl chloride.
What is the SMILES notation for 1,3-dimethylpyrazolo[5,4-b]pyridine-5-carbonyl chloride?
The canonical SMILES for 1,3-dimethylpyrazolo[5,4-b]pyridine-5-carbonyl chloride is Cc1nn(C)c2ncc(C(=O)Cl)cc12.
What is the InChIKey of 1,3-dimethylpyrazolo[5,4-b]pyridine-5-carbonyl chloride?
The InChIKey is BPYULXLPWORSAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClN3O/c1-5-7-3-6(8(10)14)4-11-9(7)13(2)12-5/h3-4H,1-2H3.
What are the key properties of 1,3-dimethylpyrazolo[5,4-b]pyridine-5-carbonyl chloride?
1,3-dimethylpyrazolo[5,4-b]pyridine-5-carbonyl chloride has a molecular weight of 209.64 g/mol, XLogP of 1.66, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylpyrazolo[5,4-b]pyridine-5-carbonyl chloride is sourced from PubChem (CID 45081942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).