About 3-ethyl-2,3-dihydroindole-1-carbonyl chloride
3-ethyl-2,3-dihydroindole-1-carbonyl chloride (PubChem CID 45081952) has the molecular formula C11H12ClNO
and a molecular weight of 209.68 g/mol. Its IUPAC name is 3-ethyl-2,3-dihydroindole-1-carbonyl chloride.
Molecular Properties
| Compound Name | 3-ethyl-2,3-dihydroindole-1-carbonyl chloride |
| PubChem CID | 45081952 |
| Molecular Formula | C11H12ClNO |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 3-ethyl-2,3-dihydroindole-1-carbonyl chloride |
| SMILES | CCC1CN(C(=O)Cl)c2ccccc21 |
| InChI | InChI=1S/C11H12ClNO/c1-2-8-7-13(11(12)14)10-6-4-3-5-9(8)10/h3-6,8H,2,7H2,1H3 |
| InChIKey | BYTVMGNFKKBKLJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-2,3-dihydroindole-1-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2,3-dihydroindole-1-carbonyl chloride?
The IUPAC name of 3-ethyl-2,3-dihydroindole-1-carbonyl chloride (CID 45081952) is 3-ethyl-2,3-dihydroindole-1-carbonyl chloride.
What is the SMILES notation for 3-ethyl-2,3-dihydroindole-1-carbonyl chloride?
The canonical SMILES for 3-ethyl-2,3-dihydroindole-1-carbonyl chloride is CCC1CN(C(=O)Cl)c2ccccc21.
What is the InChIKey of 3-ethyl-2,3-dihydroindole-1-carbonyl chloride?
The InChIKey is BYTVMGNFKKBKLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO/c1-2-8-7-13(11(12)14)10-6-4-3-5-9(8)10/h3-6,8H,2,7H2,1H3.
What are the key properties of 3-ethyl-2,3-dihydroindole-1-carbonyl chloride?
3-ethyl-2,3-dihydroindole-1-carbonyl chloride has a molecular weight of 209.68 g/mol, XLogP of 3.36, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2,3-dihydroindole-1-carbonyl chloride is sourced from PubChem (CID 45081952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).