C8H13NO2 — CID 45082154
methyl (2R)-4-methyl-1,2,3,6-tetrahydropyridine-2-carboxylate (PubChem CID 45082154) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is methyl (2R)-4-methyl-1,2,3,6-tetrahydropyridine-2-carboxylate.
| Compound Name | methyl (2R)-4-methyl-1,2,3,6-tetrahydropyridine-2-carboxylate |
|---|---|
| PubChem CID | 45082154 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | methyl (2R)-4-methyl-1,2,3,6-tetrahydropyridine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CC(C)=CCN1 |
| InChI | InChI=1S/C8H13NO2/c1-6-3-4-9-7(5-6)8(10)11-2/h3,7,9H,4-5H2,1-2H3/t7-/m1/s1 |
| InChIKey | ZYGCWQUQHDODAT-SSDOTTSWSA-N |
| XLogP | 0.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|