About methyl 2,5-dimethyl-4,5-dihydro-1H-imidazole-4-carboxylate
methyl 2,5-dimethyl-4,5-dihydro-1H-imidazole-4-carboxylate (PubChem CID 45082182) has the molecular formula C7H12N2O2
and a molecular weight of 156.18 g/mol. Its IUPAC name is methyl 2,5-dimethyl-4,5-dihydro-1H-imidazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2,5-dimethyl-4,5-dihydro-1H-imidazole-4-carboxylate |
| PubChem CID | 45082182 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | methyl 2,5-dimethyl-4,5-dihydro-1H-imidazole-4-carboxylate |
| SMILES | COC(=O)C1N=C(C)NC1C |
| InChI | InChI=1S/C7H12N2O2/c1-4-6(7(10)11-3)9-5(2)8-4/h4,6H,1-3H3,(H,8,9) |
| InChIKey | KVILWPRZUNHTLQ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2,5-dimethyl-4,5-dihydro-1H-imidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,5-dimethyl-4,5-dihydro-1H-imidazole-4-carboxylate?
The IUPAC name of methyl 2,5-dimethyl-4,5-dihydro-1H-imidazole-4-carboxylate (CID 45082182) is methyl 2,5-dimethyl-4,5-dihydro-1H-imidazole-4-carboxylate.
What is the SMILES notation for methyl 2,5-dimethyl-4,5-dihydro-1H-imidazole-4-carboxylate?
The canonical SMILES for methyl 2,5-dimethyl-4,5-dihydro-1H-imidazole-4-carboxylate is COC(=O)C1N=C(C)NC1C.
What is the InChIKey of methyl 2,5-dimethyl-4,5-dihydro-1H-imidazole-4-carboxylate?
The InChIKey is KVILWPRZUNHTLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2/c1-4-6(7(10)11-3)9-5(2)8-4/h4,6H,1-3H3,(H,8,9).
What are the key properties of methyl 2,5-dimethyl-4,5-dihydro-1H-imidazole-4-carboxylate?
methyl 2,5-dimethyl-4,5-dihydro-1H-imidazole-4-carboxylate has a molecular weight of 156.18 g/mol, XLogP of -0.06, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,5-dimethyl-4,5-dihydro-1H-imidazole-4-carboxylate is sourced from PubChem (CID 45082182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).