About (4S)-2-propan-2-yl-4,5-dihydro-1,3-oxazole-4-carboxylic acid
(4S)-2-propan-2-yl-4,5-dihydro-1,3-oxazole-4-carboxylic acid (PubChem CID 45082197) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is (4S)-2-propan-2-yl-4,5-dihydro-1,3-oxazole-4-carboxylic acid.
Molecular Properties
| Compound Name | (4S)-2-propan-2-yl-4,5-dihydro-1,3-oxazole-4-carboxylic acid |
| PubChem CID | 45082197 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | (4S)-2-propan-2-yl-4,5-dihydro-1,3-oxazole-4-carboxylic acid |
| SMILES | CC(C)C1=N[C@H](C(=O)O)CO1 |
| InChI | InChI=1S/C7H11NO3/c1-4(2)6-8-5(3-11-6)7(9)10/h4-5H,3H2,1-2H3,(H,9,10)/t5-/m0/s1 |
| InChIKey | VAJPROOEDQJSQS-YFKPBYRVSA-N |
| XLogP | 0.52 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-2-propan-2-yl-4,5-dihydro-1,3-oxazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2-propan-2-yl-4,5-dihydro-1,3-oxazole-4-carboxylic acid?
The IUPAC name of (4S)-2-propan-2-yl-4,5-dihydro-1,3-oxazole-4-carboxylic acid (CID 45082197) is (4S)-2-propan-2-yl-4,5-dihydro-1,3-oxazole-4-carboxylic acid.
What is the SMILES notation for (4S)-2-propan-2-yl-4,5-dihydro-1,3-oxazole-4-carboxylic acid?
The canonical SMILES for (4S)-2-propan-2-yl-4,5-dihydro-1,3-oxazole-4-carboxylic acid is CC(C)C1=N[C@H](C(=O)O)CO1.
What is the InChIKey of (4S)-2-propan-2-yl-4,5-dihydro-1,3-oxazole-4-carboxylic acid?
The InChIKey is VAJPROOEDQJSQS-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H11NO3/c1-4(2)6-8-5(3-11-6)7(9)10/h4-5H,3H2,1-2H3,(H,9,10)/t5-/m0/s1.
What are the key properties of (4S)-2-propan-2-yl-4,5-dihydro-1,3-oxazole-4-carboxylic acid?
(4S)-2-propan-2-yl-4,5-dihydro-1,3-oxazole-4-carboxylic acid has a molecular weight of 157.17 g/mol, XLogP of 0.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2-propan-2-yl-4,5-dihydro-1,3-oxazole-4-carboxylic acid is sourced from PubChem (CID 45082197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).