methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate

C6H10N4O2 — CID 45082738

IUPACmethyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate
SMILESCOC(=O)C(N)Cn1cncn1
InChIInChI=1S/C6H10N4O2/c1-12-6(11)5(7)2-10-4-8-3-9-10/h3-5H,2,7H2,1H3
InChIKeyOBOYXULYXLNOKL-UHFFFAOYSA-N
MW170.17 g/mol
LogP-1.22
Rot. Bonds3

About methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate

methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate (PubChem CID 45082738) has the molecular formula C6H10N4O2 and a molecular weight of 170.17 g/mol. Its IUPAC name is methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate.

Molecular Properties

Compound Namemethyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate
PubChem CID45082738
Molecular FormulaC6H10N4O2
Molecular Weight170.17 g/mol
Exact Mass170.08
IUPAC Namemethyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate
SMILESCOC(=O)C(N)Cn1cncn1
InChIInChI=1S/C6H10N4O2/c1-12-6(11)5(7)2-10-4-8-3-9-10/h3-5H,2,7H2,1H3
InChIKeyOBOYXULYXLNOKL-UHFFFAOYSA-N
XLogP-1.22
TPSA83.03 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.17
LogP ≤ 5-1.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate?
The IUPAC name of methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate (CID 45082738) is methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate.
What is the SMILES notation for methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate?
The canonical SMILES for methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate is COC(=O)C(N)Cn1cncn1.
What is the InChIKey of methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate?
The InChIKey is OBOYXULYXLNOKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O2/c1-12-6(11)5(7)2-10-4-8-3-9-10/h3-5H,2,7H2,1H3.
What are the key properties of methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate?
methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate has a molecular weight of 170.17 g/mol, XLogP of -1.22, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate is sourced from PubChem (CID 45082738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).