About methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate
methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate (PubChem CID 45082738) has the molecular formula C6H10N4O2
and a molecular weight of 170.17 g/mol. Its IUPAC name is methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate.
Molecular Properties
| Compound Name | methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate |
| PubChem CID | 45082738 |
| Molecular Formula | C6H10N4O2 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate |
| SMILES | COC(=O)C(N)Cn1cncn1 |
| InChI | InChI=1S/C6H10N4O2/c1-12-6(11)5(7)2-10-4-8-3-9-10/h3-5H,2,7H2,1H3 |
| InChIKey | OBOYXULYXLNOKL-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate?
The IUPAC name of methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate (CID 45082738) is methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate.
What is the SMILES notation for methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate?
The canonical SMILES for methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate is COC(=O)C(N)Cn1cncn1.
What is the InChIKey of methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate?
The InChIKey is OBOYXULYXLNOKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O2/c1-12-6(11)5(7)2-10-4-8-3-9-10/h3-5H,2,7H2,1H3.
What are the key properties of methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate?
methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate has a molecular weight of 170.17 g/mol, XLogP of -1.22, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-3-(1,2,4-triazol-1-yl)propanoate is sourced from PubChem (CID 45082738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).