About 1H-indole-2,5-diol
1H-indole-2,5-diol (PubChem CID 45082883) has the molecular formula C8H7NO2
and a molecular weight of 149.15 g/mol. Its IUPAC name is 1H-indole-2,5-diol.
Molecular Properties
| Compound Name | 1H-indole-2,5-diol |
| PubChem CID | 45082883 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 1H-indole-2,5-diol |
| SMILES | Oc1ccc2[nH]c(O)cc2c1 |
| InChI | InChI=1S/C8H7NO2/c10-6-1-2-7-5(3-6)4-8(11)9-7/h1-4,9-11H |
| InChIKey | WCMNKJSRZUKXDL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-indole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole-2,5-diol?
The IUPAC name of 1H-indole-2,5-diol (CID 45082883) is 1H-indole-2,5-diol.
What is the SMILES notation for 1H-indole-2,5-diol?
The canonical SMILES for 1H-indole-2,5-diol is Oc1ccc2[nH]c(O)cc2c1.
What is the InChIKey of 1H-indole-2,5-diol?
The InChIKey is WCMNKJSRZUKXDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2/c10-6-1-2-7-5(3-6)4-8(11)9-7/h1-4,9-11H.
What are the key properties of 1H-indole-2,5-diol?
1H-indole-2,5-diol has a molecular weight of 149.15 g/mol, XLogP of 1.58, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole-2,5-diol is sourced from PubChem (CID 45082883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).