About 4-methyl-3,6-dioxocyclohexa-1,4-diene-1-carbaldehyde
4-methyl-3,6-dioxocyclohexa-1,4-diene-1-carbaldehyde (PubChem CID 45082930) has the molecular formula C8H6O3
and a molecular weight of 150.13 g/mol. Its IUPAC name is 4-methyl-3,6-dioxocyclohexa-1,4-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 4-methyl-3,6-dioxocyclohexa-1,4-diene-1-carbaldehyde |
| PubChem CID | 45082930 |
| Molecular Formula | C8H6O3 |
| Molecular Weight | 150.13 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | 4-methyl-3,6-dioxocyclohexa-1,4-diene-1-carbaldehyde |
| SMILES | CC1=CC(=O)C(C=O)=CC1=O |
| InChI | InChI=1S/C8H6O3/c1-5-2-8(11)6(4-9)3-7(5)10/h2-4H,1H3 |
| InChIKey | AVNXGAZHGSPSMX-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.13 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3,6-dioxocyclohexa-1,4-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3,6-dioxocyclohexa-1,4-diene-1-carbaldehyde?
The IUPAC name of 4-methyl-3,6-dioxocyclohexa-1,4-diene-1-carbaldehyde (CID 45082930) is 4-methyl-3,6-dioxocyclohexa-1,4-diene-1-carbaldehyde.
What is the SMILES notation for 4-methyl-3,6-dioxocyclohexa-1,4-diene-1-carbaldehyde?
The canonical SMILES for 4-methyl-3,6-dioxocyclohexa-1,4-diene-1-carbaldehyde is CC1=CC(=O)C(C=O)=CC1=O.
What is the InChIKey of 4-methyl-3,6-dioxocyclohexa-1,4-diene-1-carbaldehyde?
The InChIKey is AVNXGAZHGSPSMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O3/c1-5-2-8(11)6(4-9)3-7(5)10/h2-4H,1H3.
What are the key properties of 4-methyl-3,6-dioxocyclohexa-1,4-diene-1-carbaldehyde?
4-methyl-3,6-dioxocyclohexa-1,4-diene-1-carbaldehyde has a molecular weight of 150.13 g/mol, XLogP of 0.21, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3,6-dioxocyclohexa-1,4-diene-1-carbaldehyde is sourced from PubChem (CID 45082930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).