C7H11N3O — CID 45083024
6-methyl-1,3,4,5,6,7-hexahydroimidazo[4,5-c]pyridin-2-one (PubChem CID 45083024) has the molecular formula C7H11N3O and a molecular weight of 153.19 g/mol. Its IUPAC name is 6-methyl-1,3,4,5,6,7-hexahydroimidazo[4,5-c]pyridin-2-one.
| Compound Name | 6-methyl-1,3,4,5,6,7-hexahydroimidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 45083024 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 6-methyl-1,3,4,5,6,7-hexahydroimidazo[4,5-c]pyridin-2-one |
| SMILES | CC1Cc2[nH]c(=O)[nH]c2CN1 |
| InChI | InChI=1S/C7H11N3O/c1-4-2-5-6(3-8-4)10-7(11)9-5/h4,8H,2-3H2,1H3,(H2,9,10,11) |
| InChIKey | IFJMXXGTKYMGTJ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |