C7H9NO3 — CID 45083131
(8S,8aS)-8-hydroxy-1,5,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 45083131) has the molecular formula C7H9NO3 and a molecular weight of 155.15 g/mol. Its IUPAC name is (8S,8aS)-8-hydroxy-1,5,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | (8S,8aS)-8-hydroxy-1,5,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 45083131 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | (8S,8aS)-8-hydroxy-1,5,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | O=C1OC[C@H]2[C@@H](O)C=CCN12 |
| InChI | InChI=1S/C7H9NO3/c9-6-2-1-3-8-5(6)4-11-7(8)10/h1-2,5-6,9H,3-4H2/t5-,6-/m0/s1 |
| InChIKey | HGLFTKVZIXIWEB-WDSKDSINSA-N |
| XLogP | -0.26 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|