About (3S,6R)-3-propan-2-yl-1,4-oxazepan-6-ol
(3S,6R)-3-propan-2-yl-1,4-oxazepan-6-ol (PubChem CID 45083298) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is (3S,6R)-3-propan-2-yl-1,4-oxazepan-6-ol.
Molecular Properties
| Compound Name | (3S,6R)-3-propan-2-yl-1,4-oxazepan-6-ol |
| PubChem CID | 45083298 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | (3S,6R)-3-propan-2-yl-1,4-oxazepan-6-ol |
| SMILES | CC(C)[C@H]1COC[C@H](O)CN1 |
| InChI | InChI=1S/C8H17NO2/c1-6(2)8-5-11-4-7(10)3-9-8/h6-10H,3-5H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | ASGQGUCZNLSHME-HTQZYQBOSA-N |
| XLogP | -0.01 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,6R)-3-propan-2-yl-1,4-oxazepan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,6R)-3-propan-2-yl-1,4-oxazepan-6-ol?
The IUPAC name of (3S,6R)-3-propan-2-yl-1,4-oxazepan-6-ol (CID 45083298) is (3S,6R)-3-propan-2-yl-1,4-oxazepan-6-ol.
What is the SMILES notation for (3S,6R)-3-propan-2-yl-1,4-oxazepan-6-ol?
The canonical SMILES for (3S,6R)-3-propan-2-yl-1,4-oxazepan-6-ol is CC(C)[C@H]1COC[C@H](O)CN1.
What is the InChIKey of (3S,6R)-3-propan-2-yl-1,4-oxazepan-6-ol?
The InChIKey is ASGQGUCZNLSHME-HTQZYQBOSA-N. The full InChI is InChI=1S/C8H17NO2/c1-6(2)8-5-11-4-7(10)3-9-8/h6-10H,3-5H2,1-2H3/t7-,8-/m1/s1.
What are the key properties of (3S,6R)-3-propan-2-yl-1,4-oxazepan-6-ol?
(3S,6R)-3-propan-2-yl-1,4-oxazepan-6-ol has a molecular weight of 159.23 g/mol, XLogP of -0.01, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,6R)-3-propan-2-yl-1,4-oxazepan-6-ol is sourced from PubChem (CID 45083298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).