About 3,5-dihydroxy-6-methoxy-2,3-dihydropyran-4-one
3,5-dihydroxy-6-methoxy-2,3-dihydropyran-4-one (PubChem CID 45083338) has the molecular formula C6H8O5
and a molecular weight of 160.12 g/mol. Its IUPAC name is 3,5-dihydroxy-6-methoxy-2,3-dihydropyran-4-one.
Molecular Properties
| Compound Name | 3,5-dihydroxy-6-methoxy-2,3-dihydropyran-4-one |
| PubChem CID | 45083338 |
| Molecular Formula | C6H8O5 |
| Molecular Weight | 160.12 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | 3,5-dihydroxy-6-methoxy-2,3-dihydropyran-4-one |
| SMILES | COC1=C(O)C(=O)C(O)CO1 |
| InChI | InChI=1S/C6H8O5/c1-10-6-5(9)4(8)3(7)2-11-6/h3,7,9H,2H2,1H3 |
| InChIKey | DJWMHWRCRMAKJQ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.12 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,5-dihydroxy-6-methoxy-2,3-dihydropyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dihydroxy-6-methoxy-2,3-dihydropyran-4-one?
The IUPAC name of 3,5-dihydroxy-6-methoxy-2,3-dihydropyran-4-one (CID 45083338) is 3,5-dihydroxy-6-methoxy-2,3-dihydropyran-4-one.
What is the SMILES notation for 3,5-dihydroxy-6-methoxy-2,3-dihydropyran-4-one?
The canonical SMILES for 3,5-dihydroxy-6-methoxy-2,3-dihydropyran-4-one is COC1=C(O)C(=O)C(O)CO1.
What is the InChIKey of 3,5-dihydroxy-6-methoxy-2,3-dihydropyran-4-one?
The InChIKey is DJWMHWRCRMAKJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O5/c1-10-6-5(9)4(8)3(7)2-11-6/h3,7,9H,2H2,1H3.
What are the key properties of 3,5-dihydroxy-6-methoxy-2,3-dihydropyran-4-one?
3,5-dihydroxy-6-methoxy-2,3-dihydropyran-4-one has a molecular weight of 160.12 g/mol, XLogP of -0.68, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dihydroxy-6-methoxy-2,3-dihydropyran-4-one is sourced from PubChem (CID 45083338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).