About cis-(1S,2R)-2-trimethylsilylcyclopropane-1-carbaldehyde
cis-(1S,2R)-2-trimethylsilylcyclopropane-1-carbaldehyde (PubChem CID 45083467) has the molecular formula C7H14OSi
and a molecular weight of 142.27 g/mol. Its IUPAC name is cis-(1S,2R)-2-trimethylsilylcyclopropane-1-carbaldehyde.
Molecular Properties
| Compound Name | cis-(1S,2R)-2-trimethylsilylcyclopropane-1-carbaldehyde |
| PubChem CID | 45083467 |
| Molecular Formula | C7H14OSi |
| Molecular Weight | 142.27 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | cis-(1S,2R)-2-trimethylsilylcyclopropane-1-carbaldehyde |
| SMILES | C[Si](C)(C)[C@@H]1C[C@H]1C=O |
| InChI | InChI=1S/C7H14OSi/c1-9(2,3)7-4-6(7)5-8/h5-7H,4H2,1-3H3/t6-,7+/m0/s1 |
| InChIKey | BEZSLPRPTOOYGF-NKWVEPMBSA-N |
| XLogP | 1.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cis-(1S,2R)-2-trimethylsilylcyclopropane-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-2-trimethylsilylcyclopropane-1-carbaldehyde?
The IUPAC name of cis-(1S,2R)-2-trimethylsilylcyclopropane-1-carbaldehyde (CID 45083467) is cis-(1S,2R)-2-trimethylsilylcyclopropane-1-carbaldehyde.
What is the SMILES notation for cis-(1S,2R)-2-trimethylsilylcyclopropane-1-carbaldehyde?
The canonical SMILES for cis-(1S,2R)-2-trimethylsilylcyclopropane-1-carbaldehyde is C[Si](C)(C)[C@@H]1C[C@H]1C=O.
What is the InChIKey of cis-(1S,2R)-2-trimethylsilylcyclopropane-1-carbaldehyde?
The InChIKey is BEZSLPRPTOOYGF-NKWVEPMBSA-N. The full InChI is InChI=1S/C7H14OSi/c1-9(2,3)7-4-6(7)5-8/h5-7H,4H2,1-3H3/t6-,7+/m0/s1.
What are the key properties of cis-(1S,2R)-2-trimethylsilylcyclopropane-1-carbaldehyde?
cis-(1S,2R)-2-trimethylsilylcyclopropane-1-carbaldehyde has a molecular weight of 142.27 g/mol, XLogP of 1.91, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-2-trimethylsilylcyclopropane-1-carbaldehyde is sourced from PubChem (CID 45083467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).