About imidazo[1,2-b]pyridazine-3-carbaldehyde
imidazo[1,2-b]pyridazine-3-carbaldehyde (PubChem CID 45083595) has the molecular formula C7H5N3O
and a molecular weight of 147.14 g/mol. Its IUPAC name is imidazo[1,2-b]pyridazine-3-carbaldehyde.
Molecular Properties
| Compound Name | imidazo[1,2-b]pyridazine-3-carbaldehyde |
| PubChem CID | 45083595 |
| Molecular Formula | C7H5N3O |
| Molecular Weight | 147.14 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | imidazo[1,2-b]pyridazine-3-carbaldehyde |
| SMILES | O=Cc1cnc2cccnn12 |
| InChI | InChI=1S/C7H5N3O/c11-5-6-4-8-7-2-1-3-9-10(6)7/h1-5H |
| InChIKey | JDKQVARUFORQMC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.14 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze imidazo[1,2-b]pyridazine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[1,2-b]pyridazine-3-carbaldehyde?
The IUPAC name of imidazo[1,2-b]pyridazine-3-carbaldehyde (CID 45083595) is imidazo[1,2-b]pyridazine-3-carbaldehyde.
What is the SMILES notation for imidazo[1,2-b]pyridazine-3-carbaldehyde?
The canonical SMILES for imidazo[1,2-b]pyridazine-3-carbaldehyde is O=Cc1cnc2cccnn12.
What is the InChIKey of imidazo[1,2-b]pyridazine-3-carbaldehyde?
The InChIKey is JDKQVARUFORQMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O/c11-5-6-4-8-7-2-1-3-9-10(6)7/h1-5H.
What are the key properties of imidazo[1,2-b]pyridazine-3-carbaldehyde?
imidazo[1,2-b]pyridazine-3-carbaldehyde has a molecular weight of 147.14 g/mol, XLogP of 0.54, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[1,2-b]pyridazine-3-carbaldehyde is sourced from PubChem (CID 45083595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).