About 2-amino-4,5-dimethylbenzaldehyde
2-amino-4,5-dimethylbenzaldehyde (PubChem CID 45083661) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 2-amino-4,5-dimethylbenzaldehyde.
Molecular Properties
| Compound Name | 2-amino-4,5-dimethylbenzaldehyde |
| PubChem CID | 45083661 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 2-amino-4,5-dimethylbenzaldehyde |
| SMILES | Cc1cc(N)c(C=O)cc1C |
| InChI | InChI=1S/C9H11NO/c1-6-3-8(5-11)9(10)4-7(6)2/h3-5H,10H2,1-2H3 |
| InChIKey | ZLTGKIQFUWZNEV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4,5-dimethylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4,5-dimethylbenzaldehyde?
The IUPAC name of 2-amino-4,5-dimethylbenzaldehyde (CID 45083661) is 2-amino-4,5-dimethylbenzaldehyde.
What is the SMILES notation for 2-amino-4,5-dimethylbenzaldehyde?
The canonical SMILES for 2-amino-4,5-dimethylbenzaldehyde is Cc1cc(N)c(C=O)cc1C.
What is the InChIKey of 2-amino-4,5-dimethylbenzaldehyde?
The InChIKey is ZLTGKIQFUWZNEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c1-6-3-8(5-11)9(10)4-7(6)2/h3-5H,10H2,1-2H3.
What are the key properties of 2-amino-4,5-dimethylbenzaldehyde?
2-amino-4,5-dimethylbenzaldehyde has a molecular weight of 149.19 g/mol, XLogP of 1.70, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,5-dimethylbenzaldehyde is sourced from PubChem (CID 45083661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).