C8H9NO2 — CID 45083715
(1S,8R)-5-oxo-1,2,3,8-tetrahydropyrrolizine-1-carbaldehyde (PubChem CID 45083715) has the molecular formula C8H9NO2 and a molecular weight of 151.17 g/mol. Its IUPAC name is (1S,8R)-5-oxo-1,2,3,8-tetrahydropyrrolizine-1-carbaldehyde.
| Compound Name | (1S,8R)-5-oxo-1,2,3,8-tetrahydropyrrolizine-1-carbaldehyde |
|---|---|
| PubChem CID | 45083715 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | (1S,8R)-5-oxo-1,2,3,8-tetrahydropyrrolizine-1-carbaldehyde |
| SMILES | O=C[C@H]1CCN2C(=O)C=C[C@H]12 |
| InChI | InChI=1S/C8H9NO2/c10-5-6-3-4-9-7(6)1-2-8(9)11/h1-2,5-7H,3-4H2/t6-,7-/m1/s1 |
| InChIKey | DALSGABBFDNDEN-RNFRBKRXSA-N |
| XLogP | -0.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|