C7H11NO3 — CID 45083921
trans-(1R,3S)-2,2,3-trimethyl-3-nitrocyclopropane-1-carbaldehyde (PubChem CID 45083921) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is trans-(1R,3S)-2,2,3-trimethyl-3-nitrocyclopropane-1-carbaldehyde.
| Compound Name | trans-(1R,3S)-2,2,3-trimethyl-3-nitrocyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 45083921 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | trans-(1R,3S)-2,2,3-trimethyl-3-nitrocyclopropane-1-carbaldehyde |
| SMILES | CC1(C)[C@@H](C=O)[C@]1(C)[N+](=O)[O-] |
| InChI | InChI=1S/C7H11NO3/c1-6(2)5(4-9)7(6,3)8(10)11/h4-5H,1-3H3/t5-,7+/m1/s1 |
| InChIKey | HRFHCZAJEGWHDM-VDTYLAMSSA-N |
| XLogP | 0.88 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|