About 3-(oxiran-2-yl)benzamide
3-(oxiran-2-yl)benzamide (PubChem CID 45084012) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is 3-(oxiran-2-yl)benzamide.
Molecular Properties
| Compound Name | 3-(oxiran-2-yl)benzamide |
| PubChem CID | 45084012 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 3-(oxiran-2-yl)benzamide |
| SMILES | NC(=O)c1cccc(C2CO2)c1 |
| InChI | InChI=1S/C9H9NO2/c10-9(11)7-3-1-2-6(4-7)8-5-12-8/h1-4,8H,5H2,(H2,10,11) |
| InChIKey | LTNKXJKTQJSLMT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-(oxiran-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(oxiran-2-yl)benzamide?
The IUPAC name of 3-(oxiran-2-yl)benzamide (CID 45084012) is 3-(oxiran-2-yl)benzamide.
What is the SMILES notation for 3-(oxiran-2-yl)benzamide?
The canonical SMILES for 3-(oxiran-2-yl)benzamide is NC(=O)c1cccc(C2CO2)c1.
What is the InChIKey of 3-(oxiran-2-yl)benzamide?
The InChIKey is LTNKXJKTQJSLMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2/c10-9(11)7-3-1-2-6(4-7)8-5-12-8/h1-4,8H,5H2,(H2,10,11).
What are the key properties of 3-(oxiran-2-yl)benzamide?
3-(oxiran-2-yl)benzamide has a molecular weight of 163.18 g/mol, XLogP of 0.86, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(oxiran-2-yl)benzamide is sourced from PubChem (CID 45084012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).