About 2-methyl-1,4-dihydropyridine-3-carboxamide
2-methyl-1,4-dihydropyridine-3-carboxamide (PubChem CID 45084058) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is 2-methyl-1,4-dihydropyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-methyl-1,4-dihydropyridine-3-carboxamide |
| PubChem CID | 45084058 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 2-methyl-1,4-dihydropyridine-3-carboxamide |
| SMILES | CC1=C(C(N)=O)CC=CN1 |
| InChI | InChI=1S/C7H10N2O/c1-5-6(7(8)10)3-2-4-9-5/h2,4,9H,3H2,1H3,(H2,8,10) |
| InChIKey | CNYXZQHNCXRBJB-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-1,4-dihydropyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,4-dihydropyridine-3-carboxamide?
The IUPAC name of 2-methyl-1,4-dihydropyridine-3-carboxamide (CID 45084058) is 2-methyl-1,4-dihydropyridine-3-carboxamide.
What is the SMILES notation for 2-methyl-1,4-dihydropyridine-3-carboxamide?
The canonical SMILES for 2-methyl-1,4-dihydropyridine-3-carboxamide is CC1=C(C(N)=O)CC=CN1.
What is the InChIKey of 2-methyl-1,4-dihydropyridine-3-carboxamide?
The InChIKey is CNYXZQHNCXRBJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c1-5-6(7(8)10)3-2-4-9-5/h2,4,9H,3H2,1H3,(H2,8,10).
What are the key properties of 2-methyl-1,4-dihydropyridine-3-carboxamide?
2-methyl-1,4-dihydropyridine-3-carboxamide has a molecular weight of 138.17 g/mol, XLogP of 0.25, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,4-dihydropyridine-3-carboxamide is sourced from PubChem (CID 45084058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).