About 7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide
7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 45084617) has the molecular formula C7H6N4O
and a molecular weight of 162.15 g/mol. Its IUPAC name is 7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide |
| PubChem CID | 45084617 |
| Molecular Formula | C7H6N4O |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1c[nH]c2ncncc12 |
| InChI | InChI=1S/C7H6N4O/c8-6(12)4-2-10-7-5(4)1-9-3-11-7/h1-3H,(H2,8,12)(H,9,10,11) |
| InChIKey | DYMCRSCIKQMSRP-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide?
The IUPAC name of 7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide (CID 45084617) is 7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide.
What is the SMILES notation for 7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide?
The canonical SMILES for 7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide is NC(=O)c1c[nH]c2ncncc12.
What is the InChIKey of 7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide?
The InChIKey is DYMCRSCIKQMSRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O/c8-6(12)4-2-10-7-5(4)1-9-3-11-7/h1-3H,(H2,8,12)(H,9,10,11).
What are the key properties of 7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide?
7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide has a molecular weight of 162.15 g/mol, XLogP of 0.06, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide is sourced from PubChem (CID 45084617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).