About 3,4-dioxopentanal
3,4-dioxopentanal (PubChem CID 45085070) has the molecular formula C5H6O3
and a molecular weight of 114.10 g/mol. Its IUPAC name is 3,4-dioxopentanal.
Molecular Properties
| Compound Name | 3,4-dioxopentanal |
| PubChem CID | 45085070 |
| Molecular Formula | C5H6O3 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.03 |
| IUPAC Name | 3,4-dioxopentanal |
| SMILES | CC(=O)C(=O)CC=O |
| InChI | InChI=1S/C5H6O3/c1-4(7)5(8)2-3-6/h3H,2H2,1H3 |
| InChIKey | QGGCMCHYJIPQCE-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dioxopentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dioxopentanal?
The IUPAC name of 3,4-dioxopentanal (CID 45085070) is 3,4-dioxopentanal.
What is the SMILES notation for 3,4-dioxopentanal?
The canonical SMILES for 3,4-dioxopentanal is CC(=O)C(=O)CC=O.
What is the InChIKey of 3,4-dioxopentanal?
The InChIKey is QGGCMCHYJIPQCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O3/c1-4(7)5(8)2-3-6/h3H,2H2,1H3.
What are the key properties of 3,4-dioxopentanal?
3,4-dioxopentanal has a molecular weight of 114.10 g/mol, XLogP of -0.27, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dioxopentanal is sourced from PubChem (CID 45085070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).