About 2,3,4-trioxopentanal
2,3,4-trioxopentanal (PubChem CID 45085283) has the molecular formula C5H4O4
and a molecular weight of 128.08 g/mol. Its IUPAC name is 2,3,4-trioxopentanal.
Molecular Properties
| Compound Name | 2,3,4-trioxopentanal |
| PubChem CID | 45085283 |
| Molecular Formula | C5H4O4 |
| Molecular Weight | 128.08 g/mol |
| Exact Mass | 128.01 |
| IUPAC Name | 2,3,4-trioxopentanal |
| SMILES | CC(=O)C(=O)C(=O)C=O |
| InChI | InChI=1S/C5H4O4/c1-3(7)5(9)4(8)2-6/h2H,1H3 |
| InChIKey | KDLDWLXQVYMIBX-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.08 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2,3,4-trioxopentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4-trioxopentanal?
The IUPAC name of 2,3,4-trioxopentanal (CID 45085283) is 2,3,4-trioxopentanal.
What is the SMILES notation for 2,3,4-trioxopentanal?
The canonical SMILES for 2,3,4-trioxopentanal is CC(=O)C(=O)C(=O)C=O.
What is the InChIKey of 2,3,4-trioxopentanal?
The InChIKey is KDLDWLXQVYMIBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4O4/c1-3(7)5(9)4(8)2-6/h2H,1H3.
What are the key properties of 2,3,4-trioxopentanal?
2,3,4-trioxopentanal has a molecular weight of 128.08 g/mol, XLogP of -1.09, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4-trioxopentanal is sourced from PubChem (CID 45085283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).