About 6,6-difluorohex-5-en-2-one
6,6-difluorohex-5-en-2-one (PubChem CID 45085439) has the molecular formula C6H8F2O
and a molecular weight of 134.12 g/mol. Its IUPAC name is 6,6-difluorohex-5-en-2-one.
Molecular Properties
| Compound Name | 6,6-difluorohex-5-en-2-one |
| PubChem CID | 45085439 |
| Molecular Formula | C6H8F2O |
| Molecular Weight | 134.12 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 6,6-difluorohex-5-en-2-one |
| SMILES | CC(=O)CCC=C(F)F |
| InChI | InChI=1S/C6H8F2O/c1-5(9)3-2-4-6(7)8/h4H,2-3H2,1H3 |
| InChIKey | ONKZVZHCLOZBDU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.12 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6,6-difluorohex-5-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-difluorohex-5-en-2-one?
The IUPAC name of 6,6-difluorohex-5-en-2-one (CID 45085439) is 6,6-difluorohex-5-en-2-one.
What is the SMILES notation for 6,6-difluorohex-5-en-2-one?
The canonical SMILES for 6,6-difluorohex-5-en-2-one is CC(=O)CCC=C(F)F.
What is the InChIKey of 6,6-difluorohex-5-en-2-one?
The InChIKey is ONKZVZHCLOZBDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F2O/c1-5(9)3-2-4-6(7)8/h4H,2-3H2,1H3.
What are the key properties of 6,6-difluorohex-5-en-2-one?
6,6-difluorohex-5-en-2-one has a molecular weight of 134.12 g/mol, XLogP of 2.14, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-difluorohex-5-en-2-one is sourced from PubChem (CID 45085439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).