About non-8-en-5-yn-2-one
non-8-en-5-yn-2-one (PubChem CID 45085461) has the molecular formula C9H12O
and a molecular weight of 136.19 g/mol. Its IUPAC name is non-8-en-5-yn-2-one.
Molecular Properties
| Compound Name | non-8-en-5-yn-2-one |
| PubChem CID | 45085461 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | non-8-en-5-yn-2-one |
| SMILES | C=CCC#CCCC(C)=O |
| InChI | InChI=1S/C9H12O/c1-3-4-5-6-7-8-9(2)10/h3H,1,4,7-8H2,2H3 |
| InChIKey | YFVPCRSIXDSVBD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze non-8-en-5-yn-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of non-8-en-5-yn-2-one?
The IUPAC name of non-8-en-5-yn-2-one (CID 45085461) is non-8-en-5-yn-2-one.
What is the SMILES notation for non-8-en-5-yn-2-one?
The canonical SMILES for non-8-en-5-yn-2-one is C=CCC#CCCC(C)=O.
What is the InChIKey of non-8-en-5-yn-2-one?
The InChIKey is YFVPCRSIXDSVBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O/c1-3-4-5-6-7-8-9(2)10/h3H,1,4,7-8H2,2H3.
What are the key properties of non-8-en-5-yn-2-one?
non-8-en-5-yn-2-one has a molecular weight of 136.19 g/mol, XLogP of 1.94, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for non-8-en-5-yn-2-one is sourced from PubChem (CID 45085461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).