C10H17NO — CID 45086400
1-(1-propyl-3,6-dihydro-2H-pyridin-5-yl)ethanone (PubChem CID 45086400) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 1-(1-propyl-3,6-dihydro-2H-pyridin-5-yl)ethanone.
| Compound Name | 1-(1-propyl-3,6-dihydro-2H-pyridin-5-yl)ethanone |
|---|---|
| PubChem CID | 45086400 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 1-(1-propyl-3,6-dihydro-2H-pyridin-5-yl)ethanone |
| SMILES | CCCN1CCC=C(C(C)=O)C1 |
| InChI | InChI=1S/C10H17NO/c1-3-6-11-7-4-5-10(8-11)9(2)12/h5H,3-4,6-8H2,1-2H3 |
| InChIKey | SLZNXZJJJWHDSC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |